![[ICO]](/icons/blank.gif)  | Name | Last modified | Size | Description | 
   
  | 
![[PARENTDIR]](/icons/back.gif)  | Parent Directory |   |   -  |   | 
![[   ]](/icons/unknown.gif)  | 3D-mentalitet og tendensen til å tenke begrenset.doc | 2024-04-29 21:20   |  43K |   | 
![[   ]](/icons/unknown.gif)  | AlphaCentauri-Historical-Lies.doc | 2024-04-29 21:20   |  67K |   | 
![[   ]](/icons/unknown.gif)  | A Perfect Example of how a Soul becomes Strongly Attached to its past life.doc | 2024-04-29 21:20   |  42K |   | 
![[   ]](/icons/unknown.gif)  | Artificial Intelligence and the Astral.doc | 2024-04-29 21:20   |  77K |   | 
![[   ]](/icons/unknown.gif)  | Attachments and Infestations3.doc | 2024-04-29 21:20   |  55K |   | 
![[   ]](/icons/unknown.gif)  | ATHENA-SWARUU-sp-sv.doc | 2024-04-29 21:20   | 155K |   | 
![[   ]](/icons/unknown.gif)  | avhengigheter og astral angrep.doc | 2024-04-29 21:20   |  52K |   | 
![[   ]](/icons/unknown.gif)  | BigFoot.doc | 2024-04-29 21:20   |  56K |   | 
![[   ]](/icons/unknown.gif)  | Collective Unconscious.doc | 2024-04-29 21:20   |  35K |   | 
![[   ]](/icons/unknown.gif)  | Demons and Evil Entities of the Lower Astral.doc | 2024-04-29 21:20   |  32K |   | 
![[   ]](/icons/unknown.gif)  | Demons and Evil Entities of the Lower Astral Part 2.doc | 2024-04-29 21:20   |  49K |   | 
![[   ]](/icons/unknown.gif)  | Drømmer og mørke nedre astrale entitetsbesøk.doc | 2024-04-29 21:20   |  58K |   | 
![[   ]](/icons/unknown.gif)  | EXTRACTIONS AND THEIR PROBLEMS3.doc | 2024-04-29 21:20   |  55K |   | 
![[   ]](/icons/unknown.gif)  | Extractions and their problems. Part 1.doc | 2024-04-29 21:20   |  47K |   | 
![[   ]](/icons/unknown.gif)  | Extractions and their problems-eng-no.doc | 2024-04-29 21:20   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Extractions and their problems Part 2.doc | 2024-04-29 21:20   |  30K |   | 
![[   ]](/icons/unknown.gif)  | False Alien Invasion-Another Warning, mostly for Star Seeds.doc | 2024-04-29 21:20   |  54K |   | 
![[   ]](/icons/unknown.gif)  | Federation about Earth Affairs Early 2024.doc | 2024-04-29 21:20   |  34K |   | 
![[   ]](/icons/unknown.gif)  | Federation-permissive-towards-humanity-problems.doc | 2024-04-29 21:20   |  36K |   | 
![[   ]](/icons/unknown.gif)  | First Ancient Battle.doc | 2024-04-29 21:20   |  55K |   | 
![[   ]](/icons/unknown.gif)  | HIDDEN-SYMBOLOGY-TIAHUANACO-SUMER- EGYPT.doc | 2024-04-29 21:20   |  21K |   | 
![[   ]](/icons/unknown.gif)  | Invaded-Planets.doc | 2024-04-29 21:20   |  33K |   | 
![[   ]](/icons/unknown.gif)  | Is removing the Cabal advisable.doc | 2024-04-29 21:20   |  35K |   | 
![[   ]](/icons/unknown.gif)  | Jesus-Lived-in-India.doc | 2024-04-29 21:20   |  56K |   | 
![[   ]](/icons/unknown.gif)  | Kassia speaks directly to those who remember.doc | 2024-04-29 21:20   |  46K |   | 
![[   ]](/icons/unknown.gif)  | LEMURIAN SHIP ARRIVING TO EARTH TIMELINE.doc | 2024-04-29 21:20   |  34K |   | 
![[   ]](/icons/unknown.gif)  | Light Beings, Demons, Part 4-Possessions and Star Seeds.doc | 2024-04-29 21:20   |  41K |   | 
![[   ]](/icons/unknown.gif)  | Light Beings, Demons, Part 4, Religion, Possessions and Star Seeds.doc | 2024-04-29 21:20   |  41K |   | 
![[   ]](/icons/unknown.gif)  | Media communication in Taygeta.doc | 2024-04-29 21:20   |  31K |   | 
![[   ]](/icons/unknown.gif)  | Men in Taygeta.doc | 2024-04-29 21:20   |  34K |   | 
![[   ]](/icons/unknown.gif)  | New Channel Presentation-om Mari Swaruu-kanalen.doc | 2024-04-29 21:20   |  48K |   | 
![[   ]](/icons/unknown.gif)  | omGrey Aliens_eng-no.doc | 2024-04-29 21:20   |  48K |   | 
![[   ]](/icons/unknown.gif)  | omGraa_1.doc | 2024-04-29 21:20   |  48K |   | 
![[   ]](/icons/unknown.gif)  | Pets in Taygeta-Kjæledyr i Taygeta.doc | 2024-04-29 21:20   |  41K |   | 
![[   ]](/icons/unknown.gif)  | Pyramider – hvordan ble de bygget og hva tjener de til.doc | 2024-04-29 21:20   |  82K |   | 
![[   ]](/icons/unknown.gif)  | Pyramids-How Were They Built and What Do They Serve.doc | 2024-04-29 21:20   |  73K |   | 
![[   ]](/icons/unknown.gif)  | ’Påliminger’ og angrep, del 4, lavere astral, ideer og programmering.doc | 2024-04-29 21:20   |  49K |   | 
![[   ]](/icons/unknown.gif)  | religioner etc.doc | 2024-04-29 21:20   |  46K |   | 
![[   ]](/icons/unknown.gif)  | samtaleKatteraseET.doc | 2024-04-29 21:20   |  54K |   | 
![[   ]](/icons/unknown.gif)  | society-in-Taygeta-Structure.doc | 2024-04-29 21:20   |  34K |   | 
![[   ]](/icons/unknown.gif)  | Star Seeds. Part 8, Astral Projection, Astral Abductions and Night Soul Missions, Part 2.doc | 2024-04-29 21:20   |  34K |   | 
![[   ]](/icons/unknown.gif)  | Star seeds and their problems. Part 5. Remembering having lived in higher realms.doc | 2024-04-29 21:20   |  46K |   | 
![[   ]](/icons/unknown.gif)  | Star Seeds, Part 7, Astral Projection, Astral Abductions, Night Soul Missions, Part 1.doc | 2024-04-29 21:20   |  43K |   | 
![[   ]](/icons/unknown.gif)  | Swaru-JourneySoFar-2017-23.doc | 2024-04-29 21:20   |  59K |   | 
![[   ]](/icons/unknown.gif)  | Swaruu Official.doc | 2024-04-29 21:20   |  49K |   | 
![[   ]](/icons/unknown.gif)  | Taygeta-origins-and-history.doc | 2024-04-29 21:20   |  37K |   | 
![[   ]](/icons/unknown.gif)  | Telepathic Fields.doc | 2024-04-29 21:20   |  50K |   | 
![[   ]](/icons/unknown.gif)  | Extraterrestrial Engineering - Reactors-Plasma Engines.doc | 2024-04-29 21:20   | 3.2M |   | 
![[   ]](/icons/unknown.gif)  | Telepathy.doc | 2024-04-29 21:20   |  52K |   | 
![[   ]](/icons/unknown.gif)  | Telepatiske felt og dine egregors og frykt.doc | 2024-04-29 21:20   |  51K |   | 
![[   ]](/icons/unknown.gif)  | The Astral. Part 3. Important recapitulation of base concepts that describe everything.doc | 2024-04-29 21:20   |  44K |   | 
![[   ]](/icons/unknown.gif)  | The-Astral-Part2.doc | 2024-04-29 21:20   |  33K |   | 
![[   ]](/icons/unknown.gif)  | The Moon, Part 2. Internal structure.doc | 2024-04-29 21:20   |  44K |   | 
![[   ]](/icons/unknown.gif)  | The Moon-Part 1.doc | 2024-04-29 21:20   |  47K |   | 
![[   ]](/icons/unknown.gif)  | The Moon part 3.doc | 2024-04-29 21:20   |  51K |   | 
![[   ]](/icons/unknown.gif)  | The Moon, part 4, how it influences Earth’s Matrix, shady things and conclusions.doc | 2024-04-29 21:20   |  50K |   | 
![[   ]](/icons/unknown.gif)  | Urmah-intervjuet2no.doc | 2024-04-29 21:20   |  56K |   | 
![[   ]](/icons/unknown.gif)  | den2sferenPadgett.doc | 2024-05-14 22:13   |  37K |   | 
   
  |