![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[SND]](/icons/sound2.gif) | LeneOn-Formation-Ensoulment-of-Earth.mp3 | 2024-07-28 09:48 | 11M | |
![[ ]](/icons/unknown.gif) | LeneOn-Formation-Ensoulment-of-Earth.doc | 2024-07-28 09:48 | 110K | |
![[TXT]](/icons/text.gif) | omSmåfolket-eng-no.htm | 2024-07-28 09:48 | 97K | |
![[ ]](/icons/odf6odt-20x22.png) | omSmåfolket-eng-no.odt | 2024-07-28 09:48 | 75K | |
![[TXT]](/icons/text.gif) | omSmåfolket-eng-no-forlydfil.htm | 2024-07-28 09:48 | 46K | |
![[DIR]](/icons/folder.gif) | experience-reports1960-1961/ | 2024-07-23 12:38 | - | |
![[DIR]](/icons/folder.gif) | Experience-reports-58-1959/ | 2024-07-10 14:06 | - | |
![[SND]](/icons/sound2.gif) | Helene - caught in memories.mp3 | 2024-06-02 12:22 | 3.3M | |
![[ ]](/icons/layout.gif) | Experience-reports-BB1958-1959-forAudiofile.pdf | 2024-06-02 09:18 | 589K | |
![[ ]](/icons/odf6odt-20x22.png) | Wilhelm-first experiences of a soul on its deathbed and in the afterlife.odt | 2024-05-14 17:51 | 31K | |
![[ ]](/icons/unknown.gif) | Wilhelm - erste Erlebnisse einer Seele auf dem Sterbebette und im Jenseits | 2024-05-14 17:51 | 34K | |
![[ ]](/icons/odf6odt-20x22.png) | Vincenzo-insight into the spiritual battle for man-58.odt | 2024-05-14 17:51 | 33K | |
![[ ]](/icons/unknown.gif) | Vincenzo - Einblick in den geistigen Kampf um den Menschen-1958 | 2024-05-14 17:51 | 31K | |
![[ ]](/icons/unknown.gif) | Pio - Unterschiede zwischen irdischem und geistigem Ansehen. | 2024-05-14 17:51 | 13K | |
![[ ]](/icons/odf6odt-20x22.png) | Pio - Differences between earthly and spiritual reputation.odt | 2024-05-14 17:51 | 28K | |
![[ ]](/icons/odf6odt-20x22.png) | Helene-caught-in-memories.odt | 2024-05-14 17:51 | 27K | |
![[DIR]](/icons/folder.gif) | norsk/ | 2024-05-14 17:37 | - | |
![[SND]](/icons/sound2.gif) | Bb-wilhelms_expOnTheOtherSide.mp3 | 2024-05-14 17:33 | 17M | |
![[SND]](/icons/sound2.gif) | helene-liv-i-rikdom.mp3 | 2024-05-14 17:33 | 2.7M | |
![[SND]](/icons/sound2.gif) | englenesHimmelskeSpraak.mp3 | 2024-04-17 20:21 | 12M | |
![[ ]](/icons/unknown.gif) | BeatriceBrunner2017.doc | 2024-04-17 20:21 | 154K | |
![[SND]](/icons/sound2.gif) | Menneskelivet-er-vevingen-av-ditt-aandelige-plagg.mp3 | 2024-04-17 20:21 | 11M | |
![[SND]](/icons/sound2.gif) | Den velsignede dag og det velsignede liv.mp3 | 2024-04-17 20:21 | 7.7M | |
![[TXT]](/icons/text.gif) | The Heavenly Language of Angels..txt | 2024-04-17 20:21 | 26K | |
![[ ]](/icons/unknown.gif) | mennnekelivet vever sine egne aandelige plagg.doc | 2024-04-17 20:21 | 69K | |
![[SND]](/icons/sound2.gif) | Jesu lignelse om de fortapte.mp3 | 2024-04-17 20:21 | 13M | |
![[ ]](/icons/unknown.gif) | Den velsignede dag og det velsignede liv.doc | 2024-04-17 20:21 | 59K | |
![[SND]](/icons/sound2.gif) | sjalusi-primitiveTanker-Er velstand og velvære.mp3 | 2024-04-17 20:21 | 5.8M | |
![[ ]](/icons/unknown.gif) | Jesu lignelse om de fortapte.doc | 2024-04-17 20:21 | 82K | |
![[ ]](/icons/unknown.gif) | sjalusi-primitiveTanker-Er velstand og velvære.doc | 2024-04-17 20:21 | 67K | |
![[SND]](/icons/sound2.gif) | Kilder til styrke og selvtillit på livets vei.mp3 | 2024-04-17 20:21 | 5.3M | |
![[SND]](/icons/sound2.gif) | The Empty Grave-Hva skjedde etter Jesu død.mp3 | 2024-04-17 20:21 | 5.6M | |
![[ ]](/icons/unknown.gif) | Kilder til styrke og selvtillit på livets vei.doc | 2024-04-17 20:21 | 61K | |
![[ ]](/icons/unknown.gif) | The Empty Grave-Hva skjedde etter Jesu død.doc | 2024-04-17 20:21 | 103K | |
![[ ]](/icons/unknown.gif) | Fritz the Begga.doc | 2024-04-10 16:10 | 78K | |
![[SND]](/icons/sound2.gif) | aarsaker til melankol- helbredelsesveier.mp3 | 2024-04-10 16:01 | 17M | |
![[ ]](/icons/unknown.gif) | bb_spirWorld_1_22.doc | 2024-04-10 16:01 | 278K | |
![[ ]](/icons/odf6odt-20x22.png) | mulige-årsaker-til-melankoli.odt | 2024-04-10 16:01 | 63K | |
![[ ]](/icons/unknown.gif) | a Guardian Spirit Protects the Spiritual Life of a Human Being.doc | 2024-03-24 19:32 | 40K | |
![[SND]](/icons/sound2.gif) | How Prayers Are Answered-inklNorsk.mp3 | 2024-03-20 15:53 | 14M | |
![[ ]](/icons/unknown.gif) | Joseph_aarsaken bak menneskelivet.doc | 2024-03-20 15:53 | 74K | |
![[SND]](/icons/sound2.gif) | Effekten av bønner for den avdøde.mp3 | 2024-03-20 15:53 | 8.9M | |
![[ ]](/icons/unknown.gif) | How-Prayers-Are-Answered_eng_no.doc | 2024-03-20 15:53 | 96K | |
![[ ]](/icons/unknown.gif) | nytten-av-bonner-for-avdode.doc | 2024-03-20 15:53 | 66K | |
![[SND]](/icons/sound2.gif) | VårFader-bønnen.mp3 | 2024-03-20 15:53 | 5.0M | |
![[SND]](/icons/sound2.gif) | oppvåkning-i-himmelsk-lykke.mp3 | 2024-03-20 15:52 | 11M | |
![[TXT]](/icons/text.gif) | oldbooks_onTheAstral.htm | 2024-02-11 10:54 | 164K | |
![[TXT]](/icons/text.gif) | livdod2.htm | 2024-02-11 10:54 | 81K | |
![[TXT]](/icons/text.gif) | johannes_greber.html | 2024-02-11 10:54 | 95K | |
![[TXT]](/icons/text.gif) | boenma.html | 2024-02-11 10:54 | 40K | |
![[ ]](/icons/layout.gif) | UFOs and Spirit Comm_Greber_meier.pdf | 2024-02-11 10:53 | 562K | |
![[ ]](/icons/unknown.gif) | UFOs and Spirit CommGreber_meier.doc | 2024-02-11 10:53 | 672K | |
![[ ]](/icons/unknown.gif) | Vår Fader-bønnen.doc | 2024-02-11 10:53 | 51K | |
![[TXT]](/icons/text.gif) | veierTilEvigheten.txt | 2024-02-07 10:37 | 19K | |
![[TXT]](/icons/text.gif) | åndeligeStederNærJorden.txt | 2024-02-07 10:37 | 46K | |
![[TXT]](/icons/text.gif) | The Sleep Life of Human Beings.txt | 2024-02-07 10:37 | 33K | |
![[TXT]](/icons/text.gif) | The Earthly, Material World Is Condensation of Spirit.txt | 2024-02-07 10:37 | 55K | |
![[TXT]](/icons/text.gif) | Spiritual Consequences of drug and alcohol.txt | 2024-02-07 10:37 | 80K | |
![[TXT]](/icons/text.gif) | The Distinction between Fates.txt | 2024-02-07 10:37 | 23K | |
![[TXT]](/icons/text.gif) | spiritAnimalsAsGuides.txt | 2024-02-07 10:37 | 22K | |
![[TXT]](/icons/text.gif) | soulsShareInEternity.txt | 2024-02-07 10:37 | 24K | |
![[SND]](/icons/sound2.gif) | veienOppFraMorkePlan.mp3 | 2024-02-07 10:37 | 7.2M | |
![[TXT]](/icons/text.gif) | rednFraHelvSonene.txt | 2024-02-07 10:37 | 28K | |
![[TXT]](/icons/text.gif) | prepNewJordisk_ink.txt | 2024-02-07 10:37 | 26K | |
![[TXT]](/icons/text.gif) | old-Feelings of Guilt Plague the Soul.txt | 2024-02-07 10:37 | 7.5K | |
![[TXT]](/icons/text.gif) | Menneskets søvnliv eng no webutg.htm | 2024-02-07 10:37 | 89K | |
![[TXT]](/icons/text.gif) | joseph Questions and Answers from 1951 to 1977.txt | 2024-02-07 10:37 | 13K | |
![[TXT]](/icons/text.gif) | Believing, yet Without Belief.txt | 2024-02-07 10:37 | 21K | |
![[TXT]](/icons/text.gif) | bbkladd.txt | 2024-02-07 10:37 | 16K | |
![[SND]](/icons/sound2.gif) | TemporarySeparation.mp3 | 2024-02-07 10:37 | 8.2M | |
![[SND]](/icons/sound2.gif) | tro_med_og-uten_denAa-verden.mp3 | 2024-02-07 10:37 | 5.5M | |
![[SND]](/icons/sound2.gif) | SpSvfrom1951 to1977.mp3 | 2024-02-07 10:37 | 3.4M | |
![[SND]](/icons/sound2.gif) | skytsenglenesNattligePaavirkninger.mp3 | 2024-02-07 10:37 | 5.4M | |
![[SND]](/icons/sound2.gif) | pluseligOvergangForUngtPar.mp3 | 2024-02-07 10:37 | 6.2M | |
![[SND]](/icons/sound2.gif) | sjelensAndel-i-evigheten.mp3 | 2024-02-07 10:37 | 3.0M | |
![[SND]](/icons/sound2.gif) | Når gamle skyldfølelser plager sjelen.mp3 | 2024-02-07 10:37 | 2.0M | |
![[SND]](/icons/sound2.gif) | musikk_paa_aandeligePlan.mp3 | 2024-02-07 10:37 | 4.3M | |
![[SND]](/icons/sound2.gif) | MariaHerInitialExperiencesAndreSiden.mp3 | 2024-02-07 10:37 | 8.3M | |
![[SND]](/icons/sound2.gif) | kristusPlanlaSinInkOgskjebne_og_Hjelpere.mp3 | 2024-02-07 10:37 | 7.0M | |
![[SND]](/icons/sound2.gif) | konsekvensAvNorkotikaOgRus.mp3 | 2024-02-07 10:37 | 10M | |
![[SND]](/icons/sound2.gif) | kontrollere_depresjoner.mp3 | 2024-02-07 10:37 | 4.0M | |
![[SND]](/icons/sound2.gif) | forskj_karmiskSkjebne.mp3 | 2024-02-07 10:37 | 6.0M | |
![[SND]](/icons/sound2.gif) | innhold_i_materielet.mp3 | 2024-02-07 10:37 | 2.3M | |
![[SND]](/icons/sound2.gif) | evightensVeier_oppstignGjennomLaverePlan.mp3 | 2024-02-07 10:37 | 3.4M | |
![[SND]](/icons/sound2.gif) | dom_i_dgv.mp3 | 2024-02-07 10:37 | 7.3M | |
![[SND]](/icons/sound2.gif) | deBlindfødte.mp3 | 2024-02-07 10:37 | 3.5M | |
![[SND]](/icons/sound2.gif) | A Deathbed Experience.mp3 | 2024-02-07 10:37 | 7.8M | |
![[SND]](/icons/sound2.gif) | bl_a_om_kampen_mellom_lys_morke_engl.mp3 | 2024-02-07 10:37 | 4.8M | |
![[ ]](/icons/layout.gif) | omMusikk_AA_verden.pdf | 2024-02-07 10:37 | 6.5M | |
![[ ]](/icons/unknown.gif) | Åndelige konsekvenser av rusbruk.doc | 2024-02-07 10:37 | 51K | |
![[ ]](/icons/unknown.gif) | veienUtAvMorkePlan.doc | 2024-02-07 10:37 | 84K | |
![[ ]](/icons/unknown.gif) | The Colorful Experience of Music in the High Heavens_no.doc | 2024-02-07 10:37 | 35K | |
![[ ]](/icons/unknown.gif) | Temporary SeparationBb.doc | 2024-02-07 10:37 | 51K | |
![[ ]](/icons/unknown.gif) | Spirit Reach the Consciousness of a Human.doc | 2024-02-07 10:37 | 68K | |
![[ ]](/icons/unknown.gif) | Prayer as a Comfort and a Balm_reserve.doc | 2024-02-07 10:37 | 32K | |
![[ ]](/icons/unknown.gif) | Prayer as a Comfort and a Balm.doc | 2024-02-07 10:37 | 32K | |
![[ ]](/icons/unknown.gif) | Plutselig dødelig ulykke for et gift par.doc | 2024-02-07 10:37 | 68K | |
![[ ]](/icons/layout.gif) | omMusikk_AA_verdenB.pdf | 2024-02-07 10:37 | 1.2M | |
![[ ]](/icons/unknown.gif) | Old Feelings of Guilt Plague the Soul.doc | 2024-02-07 10:37 | 35K | |
![[ ]](/icons/unknown.gif) | Near-Earth Spiritual Places.doc | 2024-02-07 10:37 | 75K | |
![[ ]](/icons/unknown.gif) | Menneskets søvnliv SpSv_eng_no.doc | 2024-02-07 10:37 | 40K | |
![[ ]](/icons/unknown.gif) | Menneskets søvnliv eng no.doc | 2024-02-07 10:37 | 98K | |
![[ ]](/icons/unknown.gif) | Menneskets søvnliv eng.doc | 2024-02-07 10:37 | 53K | |
![[ ]](/icons/layout.gif) | Bb_omTilgivelse.pdf | 2024-02-07 10:37 | 4.2M | |
![[ ]](/icons/unknown.gif) | Marias opplevelser på andre siden.doc | 2024-02-07 10:37 | 30K | |
![[ ]](/icons/unknown.gif) | Maria –Her Initial ExperiencesInTheBeyond.doc | 2024-02-07 10:37 | 91K | |
![[ ]](/icons/unknown.gif) | joseph Questions and Answers from 1951 to 1959_no.doc | 2024-02-07 10:37 | 113K | |
![[ ]](/icons/unknown.gif) | Joseph.doc | 2024-02-07 10:37 | 77K | |
![[ ]](/icons/unknown.gif) | jesusOgDeBlindfødte.doc | 2024-02-07 10:37 | 65K | |
![[ ]](/icons/unknown.gif) | Hvordan mennesker blir dømt.doc | 2024-02-07 10:37 | 79K | |
![[ ]](/icons/unknown.gif) | En dødsleieopplevelse.doc | 2024-02-07 10:37 | 80K | |
![[ ]](/icons/unknown.gif) | Christ Himself PreparedHisLife_no_eng.doc | 2024-02-07 10:37 | 123K | |
![[ ]](/icons/unknown.gif) | Believing yet WithoutKunnskap-eng-no.doc | 2024-02-07 10:37 | 47K | |
![[DIR]](/icons/folder.gif) | german_deutch/ | 2023-09-28 06:47 | - | |
![[ ]](/icons/unknown.gif) | afterlife_examples_beaBrunner | 2023-02-06 21:08 | 354K | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0013.mp3 | 2023-02-06 19:52 | 2.4M | |
![[ ]](/icons/odf6odt-20x22.png) | afterlife_examples_beaBrunner.odt | 2023-02-06 19:52 | 5.1M | |
![[ ]](/icons/odf6odt-20x22.png) | BeatriceBrunner_no.odt | 2023-02-06 19:52 | 29K | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0012.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0011.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0010.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0009.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0008.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0007.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0006.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0005.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0004.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0003.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0002.mp3 | 2023-02-06 19:52 | 5.0M | |
![[SND]](/icons/sound2.gif) | afterlife_examples_thru_medium_bea_Brunner_0001.mp3 | 2023-02-06 19:52 | 5.0M | |
|